C14H20N2O3 — CID 106473905
3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)oxan-4-one (PubChem CID 106473905) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)oxan-4-one.
| Compound Name | 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)oxan-4-one |
|---|---|
| PubChem CID | 106473905 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)oxan-4-one |
| SMILES | O=C1CCOCC1c1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C14H20N2O3/c17-12-7-8-18-9-11(12)14-15-13(16-19-14)10-5-3-1-2-4-6-10/h10-11H,1-9H2 |
| InChIKey | WGDPLMGKJZKCGO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |