C10H12N2O2S — CID 83201031
4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)thiolan-3-one (PubChem CID 83201031) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)thiolan-3-one.
| Compound Name | 4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)thiolan-3-one |
|---|---|
| PubChem CID | 83201031 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)thiolan-3-one |
| SMILES | O=C1CSCC1c1nc(C2CCC2)no1 |
| InChI | InChI=1S/C10H12N2O2S/c13-8-5-15-4-7(8)10-11-9(12-14-10)6-2-1-3-6/h6-7H,1-5H2 |
| InChIKey | HXRILECGHYQRKN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |