C11H9N3O2S — CID 83200939
4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one (PubChem CID 83200939) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one.
| Compound Name | 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one |
|---|---|
| PubChem CID | 83200939 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)thiolan-3-one |
| SMILES | O=C1CSCC1c1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C11H9N3O2S/c15-9-6-17-5-8(9)11-13-10(14-16-11)7-1-3-12-4-2-7/h1-4,8H,5-6H2 |
| InChIKey | RBOIQEUOWNFXQW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |