C13H12N2O3S — CID 83200610
4-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one (PubChem CID 83200610) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one.
| Compound Name | 4-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one |
|---|---|
| PubChem CID | 83200610 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-[3-(phenoxymethyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one |
| SMILES | O=C1CSCC1c1nc(COc2ccccc2)no1 |
| InChI | InChI=1S/C13H12N2O3S/c16-11-8-19-7-10(11)13-14-12(15-18-13)6-17-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | BJHUWZAYQGCBAY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |