C14H16N2O3 — CID 138999515
5-(oxan-4-yl)-3-(phenoxymethyl)-1,2,4-oxadiazole (PubChem CID 138999515) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-(oxan-4-yl)-3-(phenoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(oxan-4-yl)-3-(phenoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 138999515 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-(oxan-4-yl)-3-(phenoxymethyl)-1,2,4-oxadiazole |
| SMILES | c1ccc(OCc2noc(C3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C14H16N2O3/c1-2-4-12(5-3-1)18-10-13-15-14(19-16-13)11-6-8-17-9-7-11/h1-5,11H,6-10H2 |
| InChIKey | XWBGOMHVUZKAIJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |