C12H13N3O2 — CID 54959696
3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methoxy]aniline (PubChem CID 54959696) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methoxy]aniline.
| Compound Name | 3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methoxy]aniline |
|---|---|
| PubChem CID | 54959696 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methoxy]aniline |
| SMILES | Nc1cccc(OCc2noc(C3CC3)n2)c1 |
| InChI | InChI=1S/C12H13N3O2/c13-9-2-1-3-10(6-9)16-7-11-14-12(17-15-11)8-4-5-8/h1-3,6,8H,4-5,7,13H2 |
| InChIKey | OWVQVKIEJPAPMT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|