C15H19N3O2 — CID 30029423
3-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methoxy]aniline (PubChem CID 30029423) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methoxy]aniline.
| Compound Name | 3-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methoxy]aniline |
|---|---|
| PubChem CID | 30029423 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methoxy]aniline |
| SMILES | Nc1cccc(OCc2nc(C3CCCCC3)no2)c1 |
| InChI | InChI=1S/C15H19N3O2/c16-12-7-4-8-13(9-12)19-10-14-17-15(18-20-14)11-5-2-1-3-6-11/h4,7-9,11H,1-3,5-6,10,16H2 |
| InChIKey | OKMWKWDZBPTCSA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|