C16H21N3O2 — CID 65389709
3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methoxy]aniline (PubChem CID 65389709) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methoxy]aniline.
| Compound Name | 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methoxy]aniline |
|---|---|
| PubChem CID | 65389709 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methoxy]aniline |
| SMILES | Nc1cccc(OCc2nc(C3CCCCCC3)no2)c1 |
| InChI | InChI=1S/C16H21N3O2/c17-13-8-5-9-14(10-13)20-11-15-18-16(19-21-15)12-6-3-1-2-4-7-12/h5,8-10,12H,1-4,6-7,11,17H2 |
| InChIKey | ZTLQWVGOENKUEZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|