C15H19N3O2 — CID 29045231
3-(2-phenoxyethyl)-5-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 29045231) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-(2-phenoxyethyl)-5-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | 3-(2-phenoxyethyl)-5-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 29045231 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-(2-phenoxyethyl)-5-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(OCCc2noc(C3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-2-4-13(5-3-1)19-11-8-14-17-15(20-18-14)12-6-9-16-10-7-12/h1-5,12,16H,6-11H2 |
| InChIKey | WRAQUXHYZOJQLF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |