C11H15N3O — CID 130015814
3-but-3-ynyl-5-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 130015814) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-but-3-ynyl-5-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | 3-but-3-ynyl-5-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 130015814 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-but-3-ynyl-5-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | C#CCCc1noc(C2CCNCC2)n1 |
| InChI | InChI=1S/C11H15N3O/c1-2-3-4-10-13-11(15-14-10)9-5-7-12-8-6-9/h1,9,12H,3-8H2 |
| InChIKey | ZTIVOACNRUTZQN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|