C20H29N3O4 — CID 174494902
tert-butyl formate;3-[(4-methoxyphenyl)methyl]-5-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 174494902) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl formate;3-[(4-methoxyphenyl)methyl]-5-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | tert-butyl formate;3-[(4-methoxyphenyl)methyl]-5-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 174494902 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl formate;3-[(4-methoxyphenyl)methyl]-5-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | CC(C)(C)OC=O.COc1ccc(Cc2noc(C3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C15H19N3O2.C5H10O2/c1-19-13-4-2-11(3-5-13)10-14-17-15(20-18-14)12-6-8-16-9-7-12;1-5(2,3)7-4-6/h2-5,12,16H,6-10H2,1H3;4H,1-3H3 |
| InChIKey | MYTRUXARKZZXPU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|