About 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one
4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one (PubChem CID 83201117) has the molecular formula C10H14N2O3S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one.
Molecular Properties
| Compound Name | 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one |
| PubChem CID | 83201117 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one |
| SMILES | COCCCc1noc(C2CSCC2=O)n1 |
| InChI | InChI=1S/C10H14N2O3S/c1-14-4-2-3-9-11-10(15-12-9)7-5-16-6-8(7)13/h7H,2-6H2,1H3 |
| InChIKey | XOEHBLBDBGUJIX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one?
The IUPAC name of 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one (CID 83201117) is 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one.
What is the SMILES notation for 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one?
The canonical SMILES for 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one is COCCCc1noc(C2CSCC2=O)n1.
What is the InChIKey of 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one?
The InChIKey is XOEHBLBDBGUJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3S/c1-14-4-2-3-9-11-10(15-12-9)7-5-16-6-8(7)13/h7H,2-6H2,1H3.
What are the key properties of 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one?
4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one has a molecular weight of 242.30 g/mol, XLogP of 1.05, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]thiolan-3-one is sourced from PubChem (CID 83201117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).