C14H20N2O2S — CID 80639037
2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one (PubChem CID 80639037) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one.
| Compound Name | 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 80639037 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-one |
| SMILES | O=C1CCCCCC1c1nc(C2CCCCS2)no1 |
| InChI | InChI=1S/C14H20N2O2S/c17-11-7-3-1-2-6-10(11)14-15-13(16-18-14)12-8-4-5-9-19-12/h10,12H,1-9H2 |
| InChIKey | XLLPDKQDYABOKU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |