C13H18N2O2S — CID 112753696
3-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one (PubChem CID 112753696) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one.
| Compound Name | 3-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 112753696 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-one |
| SMILES | O=C1CCCC(c2nc(C3CCCCS3)no2)C1 |
| InChI | InChI=1S/C13H18N2O2S/c16-10-5-3-4-9(8-10)13-14-12(15-17-13)11-6-1-2-7-18-11/h9,11H,1-8H2 |
| InChIKey | UAKHPVUSMYUFDR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |