C14H14N4O2S — CID 106474611
3-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine (PubChem CID 106474611) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine.
| Compound Name | 3-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
|---|---|
| PubChem CID | 106474611 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
| SMILES | NC1CCOCC1c1nc(-c2cnc3ccsc3c2)no1 |
| InChI | InChI=1S/C14H14N4O2S/c15-10-1-3-19-7-9(10)14-17-13(18-20-14)8-5-12-11(16-6-8)2-4-21-12/h2,4-6,9-10H,1,3,7,15H2 |
| InChIKey | VVRSQVRCZOKAKH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |