C13H14ClN3O2 — CID 106474272
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-amine (PubChem CID 106474272) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-amine.
| Compound Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-amine |
|---|---|
| PubChem CID | 106474272 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-amine |
| SMILES | NC1CCOCC1c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C13H14ClN3O2/c14-9-3-1-8(2-4-9)12-16-13(19-17-12)10-7-18-6-5-11(10)15/h1-4,10-11H,5-7,15H2 |
| InChIKey | KOLULGRGLVDCJS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |