C13H12Cl2N2O3 — CID 107918226
3-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-ol (PubChem CID 107918226) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 3-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-ol.
| Compound Name | 3-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-ol |
|---|---|
| PubChem CID | 107918226 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]oxan-4-ol |
| SMILES | OC1CCOCC1c1nc(-c2cc(Cl)cc(Cl)c2)no1 |
| InChI | InChI=1S/C13H12Cl2N2O3/c14-8-3-7(4-9(15)5-8)12-16-13(20-17-12)10-6-19-2-1-11(10)18/h3-5,10-11,18H,1-2,6H2 |
| InChIKey | DZWLNZLZTVUTOO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |