C15H17Cl2N3O — CID 107917827
2-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-amine (PubChem CID 107917827) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-amine.
| Compound Name | 2-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-amine |
|---|---|
| PubChem CID | 107917827 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]cycloheptan-1-amine |
| SMILES | NC1CCCCCC1c1nc(-c2cc(Cl)cc(Cl)c2)no1 |
| InChI | InChI=1S/C15H17Cl2N3O/c16-10-6-9(7-11(17)8-10)14-19-15(21-20-14)12-4-2-1-3-5-13(12)18/h6-8,12-13H,1-5,18H2 |
| InChIKey | VETIBYSJCUXPKC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |