C12H12FN3O2 — CID 66239289
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine (PubChem CID 66239289) has the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 66239289 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]oxolan-3-amine |
| SMILES | NC1COCC1c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C12H12FN3O2/c13-8-3-1-7(2-4-8)11-15-12(18-16-11)9-5-17-6-10(9)14/h1-4,9-10H,5-6,14H2 |
| InChIKey | GQACKFMRJMJYJM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |