C10H11N5O2 — CID 113329133
4-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine (PubChem CID 113329133) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine.
| Compound Name | 4-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 113329133 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 4-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
| SMILES | NC1COCC1c1nc(-c2ccncn2)no1 |
| InChI | InChI=1S/C10H11N5O2/c11-7-4-16-3-6(7)10-14-9(15-17-10)8-1-2-12-5-13-8/h1-2,5-7H,3-4,11H2 |
| InChIKey | RKOHRMYDAGQVDM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |