C12H10ClN3O3 — CID 106474806
3-chloro-2-(3-nitrophenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazole (PubChem CID 106474806) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is 3-chloro-2-(3-nitrophenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazole.
| Compound Name | 3-chloro-2-(3-nitrophenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 106474806 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-chloro-2-(3-nitrophenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazole |
| SMILES | O=[N+]([O-])c1cccc(-n2nc3c(c2Cl)COCC3)c1 |
| InChI | InChI=1S/C12H10ClN3O3/c13-12-10-7-19-5-4-11(10)14-15(12)8-2-1-3-9(6-8)16(17)18/h1-3,6H,4-5,7H2 |
| InChIKey | IEFJDZHXAQUQOP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|