C9H11N5S — CID 106475187
6-propyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione (PubChem CID 106475187) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is 6-propyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-propyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475187 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 6-propyl-2-(1H-1,2,4-triazol-5-yl)-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(-c2ncn[nH]2)[nH]1 |
| InChI | InChI=1S/C9H11N5S/c1-2-3-6-4-7(15)13-9(12-6)8-10-5-11-14-8/h4-5H,2-3H2,1H3,(H,10,11,14)(H,12,13,15) |
| InChIKey | PPFHAKUZOBXKOK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|