C11H14N4S — CID 136700027
2-(1H-imidazol-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 136700027) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-(1H-imidazol-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 136700027 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1cc(=S)nc(-c2ncc[nH]2)[nH]1 |
| InChI | InChI=1S/C11H14N4S/c1-7(2)5-8-6-9(16)15-11(14-8)10-12-3-4-13-10/h3-4,6-7H,5H2,1-2H3,(H,12,13)(H,14,15,16) |
| InChIKey | RHQCVUVMPFMDGZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|