C13H16N4S — CID 106481311
6-(2-methylpropyl)-2-(5-methylpyrimidin-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106481311) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 6-(2-methylpropyl)-2-(5-methylpyrimidin-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-methylpropyl)-2-(5-methylpyrimidin-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481311 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 6-(2-methylpropyl)-2-(5-methylpyrimidin-2-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cnc(-c2nc(=S)cc(CC(C)C)[nH]2)nc1 |
| InChI | InChI=1S/C13H16N4S/c1-8(2)4-10-5-11(18)17-13(16-10)12-14-6-9(3)7-15-12/h5-8H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | NQKHZBXCFVJVBU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|