C15H15N3S2 — CID 106481392
6-(2-methylpropyl)-2-thieno[3,2-b]pyridin-6-yl-1H-pyrimidine-4-thione (PubChem CID 106481392) has the molecular formula C15H15N3S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 6-(2-methylpropyl)-2-thieno[3,2-b]pyridin-6-yl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-methylpropyl)-2-thieno[3,2-b]pyridin-6-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481392 |
| Molecular Formula | C15H15N3S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 6-(2-methylpropyl)-2-thieno[3,2-b]pyridin-6-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1cc(=S)nc(-c2cnc3ccsc3c2)[nH]1 |
| InChI | InChI=1S/C15H15N3S2/c1-9(2)5-11-7-14(19)18-15(17-11)10-6-13-12(16-8-10)3-4-20-13/h3-4,6-9H,5H2,1-2H3,(H,17,18,19) |
| InChIKey | GMUSCVITWJXHRB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|