C11H16N2S — CID 106475282
2-(2-methylcyclopropyl)-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106475282) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-(2-methylcyclopropyl)-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(2-methylcyclopropyl)-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475282 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(2-methylcyclopropyl)-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(C2CC2C)[nH]1 |
| InChI | InChI=1S/C11H16N2S/c1-3-4-8-6-10(14)13-11(12-8)9-5-7(9)2/h6-7,9H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | GLKLWBUHELHCLS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|