C11H18N2S2 — CID 106475534
6-propan-2-yl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106475534) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 6-propan-2-yl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-propan-2-yl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475534 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6-propan-2-yl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione |
| SMILES | CCCSCc1nc(=S)cc(C(C)C)[nH]1 |
| InChI | InChI=1S/C11H18N2S2/c1-4-5-15-7-10-12-9(8(2)3)6-11(14)13-10/h6,8H,4-5,7H2,1-3H3,(H,12,13,14) |
| InChIKey | UQSRBTSHLUEVFA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|