C11H16N2S3 — CID 106476068
6-ethyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106476068) has the molecular formula C11H16N2S3 and a molecular weight of 272.46 g/mol. Its IUPAC name is 6-ethyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-ethyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476068 |
| Molecular Formula | C11H16N2S3 |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-ethyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(C2SCCSC2C)[nH]1 |
| InChI | InChI=1S/C11H16N2S3/c1-3-8-6-9(14)13-11(12-8)10-7(2)15-4-5-16-10/h6-7,10H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | JBGJUHRNVRUIOS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|