C11H16N2S2 — CID 106476149
6-ethyl-2-(thian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106476149) has the molecular formula C11H16N2S2 and a molecular weight of 240.40 g/mol. Its IUPAC name is 6-ethyl-2-(thian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-ethyl-2-(thian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476149 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 6-ethyl-2-(thian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(C2CCCCS2)[nH]1 |
| InChI | InChI=1S/C11H16N2S2/c1-2-8-7-10(14)13-11(12-8)9-5-3-4-6-15-9/h7,9H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | XXRVGRNEDOTLAA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|