C10H16N2OS — CID 106476186
6-ethyl-2-(2-methoxypropyl)-1H-pyrimidine-4-thione (PubChem CID 106476186) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 6-ethyl-2-(2-methoxypropyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-ethyl-2-(2-methoxypropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476186 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 6-ethyl-2-(2-methoxypropyl)-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(CC(C)OC)[nH]1 |
| InChI | InChI=1S/C10H16N2OS/c1-4-8-6-10(14)12-9(11-8)5-7(2)13-3/h6-7H,4-5H2,1-3H3,(H,11,12,14) |
| InChIKey | YBYPHBXMPJCTMX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|