C12H18N2S3 — CID 106476192
2-(5,6-dimethyl-1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione (PubChem CID 106476192) has the molecular formula C12H18N2S3 and a molecular weight of 286.49 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476192 |
| Molecular Formula | C12H18N2S3 |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(C2CSC(C)C(C)S2)[nH]1 |
| InChI | InChI=1S/C12H18N2S3/c1-4-9-5-11(15)14-12(13-9)10-6-16-7(2)8(3)17-10/h5,7-8,10H,4,6H2,1-3H3,(H,13,14,15) |
| InChIKey | JBXPYSVZMSWKDV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|