C10H14N2S3 — CID 106476288
2-(1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione (PubChem CID 106476288) has the molecular formula C10H14N2S3 and a molecular weight of 258.44 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476288 |
| Molecular Formula | C10H14N2S3 |
| Molecular Weight | 258.44 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-6-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(C2CSCCS2)[nH]1 |
| InChI | InChI=1S/C10H14N2S3/c1-2-7-5-9(13)12-10(11-7)8-6-14-3-4-15-8/h5,8H,2-4,6H2,1H3,(H,11,12,13) |
| InChIKey | LECMFMXPCQWNEK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|