C16H26N2O2S — CID 106477679
2-(1-ethoxy-4,4-dimethylcyclohexyl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106477679) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-(1-ethoxy-4,4-dimethylcyclohexyl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-(1-ethoxy-4,4-dimethylcyclohexyl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477679 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-(1-ethoxy-4,4-dimethylcyclohexyl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CCOC1(c2nc(=S)cc(COC)[nH]2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H26N2O2S/c1-5-20-16(8-6-15(2,3)7-9-16)14-17-12(11-19-4)10-13(21)18-14/h10H,5-9,11H2,1-4H3,(H,17,18,21) |
| InChIKey | YWKXATCBPQNXKO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|