C12H18BrN3S2 — CID 106479255
5-bromo-2-(4-methylthiomorpholin-3-yl)-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106479255) has the molecular formula C12H18BrN3S2 and a molecular weight of 348.34 g/mol. Its IUPAC name is 5-bromo-2-(4-methylthiomorpholin-3-yl)-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(4-methylthiomorpholin-3-yl)-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479255 |
| Molecular Formula | C12H18BrN3S2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 5-bromo-2-(4-methylthiomorpholin-3-yl)-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(C2CSCCN2C)nc(=S)c1Br |
| InChI | InChI=1S/C12H18BrN3S2/c1-3-4-8-10(13)12(17)15-11(14-8)9-7-18-6-5-16(9)2/h9H,3-7H2,1-2H3,(H,14,15,17) |
| InChIKey | DKPBFNGLLYLIHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|