C13H19BrN2S3 — CID 106479246
5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106479246) has the molecular formula C13H19BrN2S3 and a molecular weight of 379.41 g/mol. Its IUPAC name is 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479246 |
| Molecular Formula | C13H19BrN2S3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 5-bromo-2-(3-ethyl-1,4-dithian-2-yl)-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(C2SCCSC2CC)nc(=S)c1Br |
| InChI | InChI=1S/C13H19BrN2S3/c1-3-5-8-10(14)13(17)16-12(15-8)11-9(4-2)18-6-7-19-11/h9,11H,3-7H2,1-2H3,(H,15,16,17) |
| InChIKey | VGRVJSBYCWPTLU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|