C12H17BrN2S2 — CID 106479326
5-bromo-6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106479326) has the molecular formula C12H17BrN2S2 and a molecular weight of 333.32 g/mol. Its IUPAC name is 5-bromo-6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479326 |
| Molecular Formula | C12H17BrN2S2 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 5-bromo-6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(C2CCCCS2)nc(=S)c1Br |
| InChI | InChI=1S/C12H17BrN2S2/c1-2-5-8-10(13)12(16)15-11(14-8)9-6-3-4-7-17-9/h9H,2-7H2,1H3,(H,14,15,16) |
| InChIKey | DNOHBQMWQFSHTB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|