C14H20N2S3 — CID 106477213
2-(5,6-dimethyl-1,4-dithian-2-yl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477213) has the molecular formula C14H20N2S3 and a molecular weight of 312.53 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-dithian-2-yl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477213 |
| Molecular Formula | C14H20N2S3 |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | CC1SCC(c2nc(=S)c3c([nH]2)CCCC3)SC1C |
| InChI | InChI=1S/C14H20N2S3/c1-8-9(2)19-12(7-18-8)13-15-11-6-4-3-5-10(11)14(17)16-13/h8-9,12H,3-7H2,1-2H3,(H,15,16,17) |
| InChIKey | NOUXDCFZTDEUBT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|