C12H14BrN3S2 — CID 106479262
5-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106479262) has the molecular formula C12H14BrN3S2 and a molecular weight of 344.30 g/mol. Its IUPAC name is 5-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479262 |
| Molecular Formula | C12H14BrN3S2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 5-bromo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(Cc2nc(C)cs2)nc(=S)c1Br |
| InChI | InChI=1S/C12H14BrN3S2/c1-3-4-8-11(13)12(17)16-9(15-8)5-10-14-7(2)6-18-10/h6H,3-5H2,1-2H3,(H,15,16,17) |
| InChIKey | MUNOGOQWJNRSRV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|