C12H19BrN2S — CID 106479500
5-bromo-2,6-ditert-butyl-1H-pyrimidine-4-thione (PubChem CID 106479500) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 5-bromo-2,6-ditert-butyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2,6-ditert-butyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479500 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-bromo-2,6-ditert-butyl-1H-pyrimidine-4-thione |
| SMILES | CC(C)(C)c1nc(=S)c(Br)c(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C12H19BrN2S/c1-11(2,3)8-7(13)9(16)15-10(14-8)12(4,5)6/h1-6H3,(H,14,15,16) |
| InChIKey | JBDHXDAZAILHQK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|