C10H15BrN2S — CID 106479257
5-bromo-2,6-dipropyl-1H-pyrimidine-4-thione (PubChem CID 106479257) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is 5-bromo-2,6-dipropyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2,6-dipropyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479257 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 5-bromo-2,6-dipropyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1nc(=S)c(Br)c(CCC)[nH]1 |
| InChI | InChI=1S/C10H15BrN2S/c1-3-5-7-9(11)10(14)13-8(12-7)6-4-2/h3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | BEVOICZHCPPKAE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|