C14H13BrCl2N2S — CID 106479559
5-bromo-6-tert-butyl-2-(3,4-dichlorophenyl)-1H-pyrimidine-4-thione (PubChem CID 106479559) has the molecular formula C14H13BrCl2N2S and a molecular weight of 392.15 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(3,4-dichlorophenyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-(3,4-dichlorophenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479559 |
| Molecular Formula | C14H13BrCl2N2S |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(3,4-dichlorophenyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)(C)c1[nH]c(-c2ccc(Cl)c(Cl)c2)nc(=S)c1Br |
| InChI | InChI=1S/C14H13BrCl2N2S/c1-14(2,3)11-10(15)13(20)19-12(18-11)7-4-5-8(16)9(17)6-7/h4-6H,1-3H3,(H,18,19,20) |
| InChIKey | GWPXSMMEUOVXOY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|