C15H15BrCl2N2S — CID 106479609
5-bromo-6-tert-butyl-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidine-4-thione (PubChem CID 106479609) has the molecular formula C15H15BrCl2N2S and a molecular weight of 406.18 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479609 |
| Molecular Formula | C15H15BrCl2N2S |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-[(2,6-dichlorophenyl)methyl]-1H-pyrimidine-4-thione |
| SMILES | CC(C)(C)c1[nH]c(Cc2c(Cl)cccc2Cl)nc(=S)c1Br |
| InChI | InChI=1S/C15H15BrCl2N2S/c1-15(2,3)13-12(16)14(21)20-11(19-13)7-8-9(17)5-4-6-10(8)18/h4-6H,7H2,1-3H3,(H,19,20,21) |
| InChIKey | KWBLESSTTPRHDS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|