C15H22BrN3S — CID 106480058
5-bromo-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106480058) has the molecular formula C15H22BrN3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 5-bromo-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480058 |
| Molecular Formula | C15H22BrN3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 5-bromo-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(C2CC3CCC(C2)N3C)nc(=S)c1Br |
| InChI | InChI=1S/C15H22BrN3S/c1-8(2)13-12(16)15(20)18-14(17-13)9-6-10-4-5-11(7-9)19(10)3/h8-11H,4-7H2,1-3H3,(H,17,18,20) |
| InChIKey | SEDDLRIPDWJQAV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|