C12H17BrN2S — CID 106479093
5-bromo-6-methyl-2-(3-methylcyclohexyl)-1H-pyrimidine-4-thione (PubChem CID 106479093) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(3-methylcyclohexyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-methyl-2-(3-methylcyclohexyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479093 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-bromo-6-methyl-2-(3-methylcyclohexyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(C2CCCC(C)C2)nc(=S)c1Br |
| InChI | InChI=1S/C12H17BrN2S/c1-7-4-3-5-9(6-7)11-14-8(2)10(13)12(16)15-11/h7,9H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | BYHRCOJKMCPVON-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|