C9H16N4 — CID 127004880
5-(3-methylcyclohexyl)-1H-1,2,4-triazol-3-amine (PubChem CID 127004880) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-(3-methylcyclohexyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(3-methylcyclohexyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 127004880 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 5-(3-methylcyclohexyl)-1H-1,2,4-triazol-3-amine |
| SMILES | CC1CCCC(c2nc(N)n[nH]2)C1 |
| InChI | InChI=1S/C9H16N4/c1-6-3-2-4-7(5-6)8-11-9(10)13-12-8/h6-7H,2-5H2,1H3,(H3,10,11,12,13) |
| InChIKey | VFONPOJFJPTQHW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |