C10H13BrF2N2O2S — CID 106480555
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480555) has the molecular formula C10H13BrF2N2O2S and a molecular weight of 343.19 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480555 |
| Molecular Formula | C10H13BrF2N2O2S |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(CCOCC(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C10H13BrF2N2O2S/c1-16-4-6-9(11)10(18)15-8(14-6)2-3-17-5-7(12)13/h7H,2-5H2,1H3,(H,14,15,18) |
| InChIKey | GGZMYGGBHXAACQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|