C14H19FN2O2 — CID 106489495
methyl 3-amino-2-[(4-amino-3-fluorophenyl)methyl]-2-cyclopropylpropanoate (PubChem CID 106489495) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 3-amino-2-[(4-amino-3-fluorophenyl)methyl]-2-cyclopropylpropanoate.
| Compound Name | methyl 3-amino-2-[(4-amino-3-fluorophenyl)methyl]-2-cyclopropylpropanoate |
|---|---|
| PubChem CID | 106489495 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | methyl 3-amino-2-[(4-amino-3-fluorophenyl)methyl]-2-cyclopropylpropanoate |
| SMILES | COC(=O)C(CN)(Cc1ccc(N)c(F)c1)C1CC1 |
| InChI | InChI=1S/C14H19FN2O2/c1-19-13(18)14(8-16,10-3-4-10)7-9-2-5-12(17)11(15)6-9/h2,5-6,10H,3-4,7-8,16-17H2,1H3 |
| InChIKey | WMRDMDJUVNKLIA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|