C10H14I2NO4P — CID 10648954
1-(5-amino-2,4-diiodophenyl)-2-dimethoxyphosphorylethanol (PubChem CID 10648954) has the molecular formula C10H14I2NO4P and a molecular weight of 497.01 g/mol. Its IUPAC name is 1-(5-amino-2,4-diiodophenyl)-2-dimethoxyphosphorylethanol.
| Compound Name | 1-(5-amino-2,4-diiodophenyl)-2-dimethoxyphosphorylethanol |
|---|---|
| PubChem CID | 10648954 |
| Molecular Formula | C10H14I2NO4P |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.87 |
| IUPAC Name | 1-(5-amino-2,4-diiodophenyl)-2-dimethoxyphosphorylethanol |
| SMILES | COP(=O)(CC(O)c1cc(N)c(I)cc1I)OC |
| InChI | InChI=1S/C10H14I2NO4P/c1-16-18(15,17-2)5-10(14)6-3-9(13)8(12)4-7(6)11/h3-4,10,14H,5,13H2,1-2H3 |
| InChIKey | CSLUXAMTVLKIRV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|