C12H21NO6P2 — CID 10711962
3,5-bis(dimethoxyphosphorylmethyl)aniline (PubChem CID 10711962) has the molecular formula C12H21NO6P2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 3,5-bis(dimethoxyphosphorylmethyl)aniline.
| Compound Name | 3,5-bis(dimethoxyphosphorylmethyl)aniline |
|---|---|
| PubChem CID | 10711962 |
| Molecular Formula | C12H21NO6P2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3,5-bis(dimethoxyphosphorylmethyl)aniline |
| SMILES | COP(=O)(Cc1cc(N)cc(CP(=O)(OC)OC)c1)OC |
| InChI | InChI=1S/C12H21NO6P2/c1-16-20(14,17-2)8-10-5-11(7-12(13)6-10)9-21(15,18-3)19-4/h5-7H,8-9,13H2,1-4H3 |
| InChIKey | PQTXWXQETKDQGY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|