C13H17IN2O4 — CID 142416081
(2R)-2-[(4-amino-5-iodo-2-methoxybenzoyl)amino]-2-methylbutanoic acid (PubChem CID 142416081) has the molecular formula C13H17IN2O4 and a molecular weight of 392.19 g/mol. Its IUPAC name is (2R)-2-[(4-amino-5-iodo-2-methoxybenzoyl)amino]-2-methylbutanoic acid.
| Compound Name | (2R)-2-[(4-amino-5-iodo-2-methoxybenzoyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 142416081 |
| Molecular Formula | C13H17IN2O4 |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | (2R)-2-[(4-amino-5-iodo-2-methoxybenzoyl)amino]-2-methylbutanoic acid |
| SMILES | CC[C@@](C)(NC(=O)c1cc(I)c(N)cc1OC)C(=O)O |
| InChI | InChI=1S/C13H17IN2O4/c1-4-13(2,12(18)19)16-11(17)7-5-8(14)9(15)6-10(7)20-3/h5-6H,4,15H2,1-3H3,(H,16,17)(H,18,19)/t13-/m1/s1 |
| InChIKey | QDQHNEMWJWMWFV-CYBMUJFWSA-N |
| XLogP | 1.87 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|